C36H35N3O6S — CID 14161827
1-[(2R,3S,4R,5R)-3-(methylamino)-4-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 14161827) has the molecular formula C36H35N3O6S and a molecular weight of 637.76 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R)-3-(methylamino)-4-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4R,5R)-3-(methylamino)-4-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 14161827 |
| Molecular Formula | C36H35N3O6S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | 1-[(2R,3S,4R,5R)-3-(methylamino)-4-(4-methylphenyl)sulfonyl-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CN[C@@H]1[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C36H35N3O6S/c1-25-18-20-29(21-19-25)46(42,43)33-30(45-34(32(33)37-2)39-23-22-31(40)38-35(39)41)24-44-36(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-23,30,32-34,37H,24H2,1-2H3,(H,38,40,41)/t30-,32-,33+,34-/m1/s1 |
| InChIKey | KYJQMOGJCSDBPG-SMEQTMGHSA-N |
| XLogP | 4.18 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|