C30H29N5O7S — CID 10675141
1-[(2R,3S,4S,5R)-3-azido-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10675141) has the molecular formula C30H29N5O7S and a molecular weight of 603.66 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3-azido-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3-azido-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10675141 |
| Molecular Formula | C30H29N5O7S |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3-azido-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](S(=O)(=O)CCO)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C30H29N5O7S/c31-34-33-26-27(43(39,40)19-18-36)24(42-28(26)35-17-16-25(37)32-29(35)38)20-41-30(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-17,24,26-28,36H,18-20H2,(H,32,37,38)/t24-,26-,27-,28-/m1/s1 |
| InChIKey | TYUNVYDADOPNBC-YULOIDQLSA-N |
| XLogP | 2.90 |
| TPSA | 176.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|