C30H31N3O7S — CID 10793298
1-[(2R,3S,4S,5R)-3-amino-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10793298) has the molecular formula C30H31N3O7S and a molecular weight of 577.66 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3-amino-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3-amino-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10793298 |
| Molecular Formula | C30H31N3O7S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3-amino-4-(2-hydroxyethylsulfonyl)-5-(trityloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | N[C@@H]1[C@H](S(=O)(=O)CCO)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C30H31N3O7S/c31-26-27(41(37,38)19-18-34)24(40-28(26)33-17-16-25(35)32-29(33)36)20-39-30(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-17,24,26-28,34H,18-20,31H2,(H,32,35,36)/t24-,26-,27-,28-/m1/s1 |
| InChIKey | XFHDSNMGWOHBFP-YULOIDQLSA-N |
| XLogP | 1.55 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|