C32H35N3O8 — CID 67328476
[(2R,3S,4R,5R)-4-amino-2-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate (PubChem CID 67328476) has the molecular formula C32H35N3O8 and a molecular weight of 589.65 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-4-amino-2-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-4-amino-2-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 67328476 |
| Molecular Formula | C32H35N3O8 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | [(2R,3S,4R,5R)-4-amino-2-[[(4,4-dimethoxycyclohexa-1,5-dien-1-yl)-diphenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] acetate |
| SMILES | COC1(OC)C=CC(C(OC[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](N)[C@@H]2OC(C)=O)(c2ccccc2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C32H35N3O8/c1-21(36)42-28-25(43-29(27(28)33)35-19-16-26(37)34-30(35)38)20-41-32(22-10-6-4-7-11-22,23-12-8-5-9-13-23)24-14-17-31(39-2,40-3)18-15-24/h4-17,19,25,27-29H,18,20,33H2,1-3H3,(H,34,37,38)/t25-,27-,28-,29-/m1/s1 |
| InChIKey | DBEKJYUAWIEWGT-YXINZVNLSA-N |
| XLogP | 2.53 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|