C36H40N2O10 — CID 54226087
[(2R,3R,4R,5R)-2-[(1,1-dimethoxy-2,2,2-triphenylethoxy)methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl] acetate (PubChem CID 54226087) has the molecular formula C36H40N2O10 and a molecular weight of 660.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[(1,1-dimethoxy-2,2,2-triphenylethoxy)methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2-[(1,1-dimethoxy-2,2,2-triphenylethoxy)methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 54226087 |
| Molecular Formula | C36H40N2O10 |
| Molecular Weight | 660.72 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[(1,1-dimethoxy-2,2,2-triphenylethoxy)methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl] acetate |
| SMILES | COCCO[C@@H]1[C@H](OC(C)=O)[C@@H](COC(OC)(OC)C(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C36H40N2O10/c1-25(39)47-31-29(48-33(32(31)45-23-22-42-2)38-21-20-30(40)37-34(38)41)24-46-36(43-3,44-4)35(26-14-8-5-9-15-26,27-16-10-6-11-17-27)28-18-12-7-13-19-28/h5-21,29,31-33H,22-24H2,1-4H3,(H,37,40,41)/t29-,31-,32-,33-/m1/s1 |
| InChIKey | QFYQRHKPKWVLGT-WXQJYUTRSA-N |
| XLogP | 3.40 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|