C38H34N2O8 — CID 23245628
[(2R,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxy-2-oxoethyl)-5-(trityloxymethyl)oxolan-3-yl] benzoate (PubChem CID 23245628) has the molecular formula C38H34N2O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxy-2-oxoethyl)-5-(trityloxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxy-2-oxoethyl)-5-(trityloxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 23245628 |
| Molecular Formula | C38H34N2O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | [(2R,3R,4R,5S)-2-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxy-2-oxoethyl)-5-(trityloxymethyl)oxolan-3-yl] benzoate |
| SMILES | COC(=O)C[C@H]1[C@@H](OC(=O)c2ccccc2)[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H34N2O8/c1-45-33(42)24-30-31(47-35(40-23-22-32(41)39-37(40)44)34(30)48-36(43)26-14-6-2-7-15-26)25-46-38(27-16-8-3-9-17-27,28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-23,30-31,34-35H,24-25H2,1H3,(H,39,41,44)/t30-,31-,34-,35-/m1/s1 |
| InChIKey | MDNIARXTQXUNJO-NJANNMLCSA-N |
| XLogP | 4.85 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|