C28H25BrN2O7S — CID 125115780
[(2R,3R,4R,5S)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-2-trityloxyoxolan-3-yl] methanesulfonate (PubChem CID 125115780) has the molecular formula C28H25BrN2O7S and a molecular weight of 613.49 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-2-trityloxyoxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R,5S)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-2-trityloxyoxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 125115780 |
| Molecular Formula | C28H25BrN2O7S |
| Molecular Weight | 613.49 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | [(2R,3R,4R,5S)-4-bromo-5-(2,4-dioxopyrimidin-1-yl)-2-trityloxyoxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]1[C@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H](n2ccc(=O)[nH]c2=O)[C@@H]1Br |
| InChI | InChI=1S/C28H25BrN2O7S/c1-39(34,35)38-24-23(29)25(31-18-17-22(32)30-27(31)33)36-26(24)37-28(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18,23-26H,1H3,(H,30,32,33)/t23-,24+,25+,26+/m1/s1 |
| InChIKey | UVZKDSPZQUZHDS-RSYZFUPGSA-N |
| XLogP | 3.51 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|