C23H23IN2O4S — CID 101078035
1-[(2S,3S,4R,5R)-3-iodo-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl]pyrimidine-2,4-dione (PubChem CID 101078035) has the molecular formula C23H23IN2O4S and a molecular weight of 550.42 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5R)-3-iodo-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3S,4R,5R)-3-iodo-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101078035 |
| Molecular Formula | C23H23IN2O4S |
| Molecular Weight | 550.42 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 1-[(2S,3S,4R,5R)-3-iodo-4-phenylmethoxy-5-(phenylmethoxymethyl)thiolan-2-yl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@H]2S[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2I)c(=O)[nH]1 |
| InChI | InChI=1S/C23H23IN2O4S/c24-20-21(30-14-17-9-5-2-6-10-17)18(15-29-13-16-7-3-1-4-8-16)31-22(20)26-12-11-19(27)25-23(26)28/h1-12,18,20-22H,13-15H2,(H,25,27,28)/t18-,20+,21-,22+/m1/s1 |
| InChIKey | OIJOHPGLKOPEQW-ZDFPQIBNSA-N |
| XLogP | 3.76 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|