C30H29BrN2O5S — CID 13009443
1-[(2S,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-5-bromopyrimidine-2,4-dione (PubChem CID 13009443) has the molecular formula C30H29BrN2O5S and a molecular weight of 609.54 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-5-bromopyrimidine-2,4-dione.
| Compound Name | 1-[(2S,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-5-bromopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 13009443 |
| Molecular Formula | C30H29BrN2O5S |
| Molecular Weight | 609.54 g/mol |
| Exact Mass | 608.10 |
| IUPAC Name | 1-[(2S,3R,4R,5S)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)thiolan-2-yl]-5-bromopyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2S[C@@H](COCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1Br |
| InChI | InChI=1S/C30H29BrN2O5S/c31-24-16-33(30(35)32-28(24)34)29-27(38-19-23-14-8-3-9-15-23)26(37-18-22-12-6-2-7-13-22)25(39-29)20-36-17-21-10-4-1-5-11-21/h1-16,25-27,29H,17-20H2,(H,32,34,35)/t25-,26-,27+,29-/m0/s1 |
| InChIKey | YUSWMVOMOJNJMR-RZLMRTLUSA-N |
| XLogP | 5.30 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |