C25H26N2O4S — CID 15451680
(2R,4R,5S,6S)-11-ethyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-7-oxa-3-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 15451680) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is (2R,4R,5S,6S)-11-ethyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-7-oxa-3-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4R,5S,6S)-11-ethyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-7-oxa-3-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 15451680 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (2R,4R,5S,6S)-11-ethyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-7-oxa-3-thia-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | CCc1cn2c(nc1=O)O[C@H]1[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)S[C@H]12 |
| InChI | InChI=1S/C25H26N2O4S/c1-2-19-13-27-24-22(31-25(27)26-23(19)28)21(30-15-18-11-7-4-8-12-18)20(32-24)16-29-14-17-9-5-3-6-10-17/h3-13,20-22,24H,2,14-16H2,1H3/t20-,21-,22+,24-/m1/s1 |
| InChIKey | ZFYTUXBFKZVSRZ-PIATZUFCSA-N |
| XLogP | 3.98 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |