C24H24N2O5 — CID 11430085
(2R,4R,5S,6S)-11-methyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 11430085) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is (2R,4R,5S,6S)-11-methyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4R,5S,6S)-11-methyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 11430085 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (2R,4R,5S,6S)-11-methyl-5-phenylmethoxy-4-(phenylmethoxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | Cc1cn2c(nc1=O)O[C@H]1[C@@H](OCc3ccccc3)[C@@H](COCc3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C24H24N2O5/c1-16-12-26-23-21(31-24(26)25-22(16)27)20(29-14-18-10-6-3-7-11-18)19(30-23)15-28-13-17-8-4-2-5-9-17/h2-12,19-21,23H,13-15H2,1H3/t19-,20+,21+,23-/m1/s1 |
| InChIKey | XNZZURRVERGOJX-BESBDSHLSA-N |
| XLogP | 3.01 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |