C31H34O6 — CID 10577393
(1S,3R,5S,8S,9R,10R,11R)-9,10-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-4,7,12-trioxatricyclo[6.4.0.03,5]dodecane (PubChem CID 10577393) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is (1S,3R,5S,8S,9R,10R,11R)-9,10-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-4,7,12-trioxatricyclo[6.4.0.03,5]dodecane.
| Compound Name | (1S,3R,5S,8S,9R,10R,11R)-9,10-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-4,7,12-trioxatricyclo[6.4.0.03,5]dodecane |
|---|---|
| PubChem CID | 10577393 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (1S,3R,5S,8S,9R,10R,11R)-9,10-bis(phenylmethoxy)-11-(phenylmethoxymethyl)-4,7,12-trioxatricyclo[6.4.0.03,5]dodecane |
| SMILES | c1ccc(COC[C@H]2O[C@H]3C[C@H]4O[C@H]4CO[C@@H]3[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H34O6/c1-4-10-22(11-5-1)17-32-20-28-30(33-18-23-12-6-2-7-13-23)31(34-19-24-14-8-3-9-15-24)29-26(37-28)16-25-27(36-25)21-35-29/h1-15,25-31H,16-21H2/t25-,26+,27+,28-,29+,30-,31-/m1/s1 |
| InChIKey | IYCYUMSUHSSLKU-WBLTUXLRSA-N |
| XLogP | 4.70 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|