C41H46O8 — CID 11973331
(1S,2R,4R,5R)-2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-6,8-dioxabicyclo[3.2.1]octan-4-ol (PubChem CID 11973331) has the molecular formula C41H46O8 and a molecular weight of 666.81 g/mol. Its IUPAC name is (1S,2R,4R,5R)-2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-6,8-dioxabicyclo[3.2.1]octan-4-ol.
| Compound Name | (1S,2R,4R,5R)-2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-6,8-dioxabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 11973331 |
| Molecular Formula | C41H46O8 |
| Molecular Weight | 666.81 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | (1S,2R,4R,5R)-2-[[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]methyl]-6,8-dioxabicyclo[3.2.1]octan-4-ol |
| SMILES | O[C@@H]1C[C@H](C[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C41H46O8/c42-34-21-33(36-28-47-41(34)49-36)22-35-38(44-24-30-15-7-2-8-16-30)40(46-26-32-19-11-4-12-20-32)39(45-25-31-17-9-3-10-18-31)37(48-35)27-43-23-29-13-5-1-6-14-29/h1-20,33-42H,21-28H2/t33-,34-,35+,36-,37-,38+,39-,40-,41-/m1/s1 |
| InChIKey | QTGHUSKBQCAUOT-NSVLCBISSA-N |
| XLogP | 6.24 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.81 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |