C36H38O5 — CID 139265887
(3R,3aR,5R,6R,7R,7aS)-3-benzyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran (PubChem CID 139265887) has the molecular formula C36H38O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (3R,3aR,5R,6R,7R,7aS)-3-benzyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran.
| Compound Name | (3R,3aR,5R,6R,7R,7aS)-3-benzyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran |
|---|---|
| PubChem CID | 139265887 |
| Molecular Formula | C36H38O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (3R,3aR,5R,6R,7R,7aS)-3-benzyl-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran |
| SMILES | c1ccc(COC[C@H]2O[C@@H]3[C@H](Cc4ccccc4)CO[C@@H]3[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H38O5/c1-5-13-27(14-6-1)21-31-25-40-35-33(31)41-32(26-37-22-28-15-7-2-8-16-28)34(38-23-29-17-9-3-10-18-29)36(35)39-24-30-19-11-4-12-20-30/h1-20,31-36H,21-26H2/t31-,32-,33-,34-,35+,36+/m1/s1 |
| InChIKey | CUWKPJNYDGKSEE-WVACUTTGSA-N |
| XLogP | 6.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |