C40H43NO8 — CID 11802551
(5S)-5-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-oxazolidine-2,4-dione (PubChem CID 11802551) has the molecular formula C40H43NO8 and a molecular weight of 665.78 g/mol. Its IUPAC name is (5S)-5-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-oxazolidine-2,4-dione.
| Compound Name | (5S)-5-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 11802551 |
| Molecular Formula | C40H43NO8 |
| Molecular Weight | 665.78 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | (5S)-5-propan-2-yl-3-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)[C@@H]1OC(=O)N([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)C1=O |
| InChI | InChI=1S/C40H43NO8/c1-28(2)34-38(42)41(40(43)49-34)39-37(47-26-32-21-13-6-14-22-32)36(46-25-31-19-11-5-12-20-31)35(45-24-30-17-9-4-10-18-30)33(48-39)27-44-23-29-15-7-3-8-16-29/h3-22,28,33-37,39H,23-27H2,1-2H3/t33-,34+,35-,36+,37-,39-/m1/s1 |
| InChIKey | UXMFZKXWNIDVMB-XRXJECMRSA-N |
| XLogP | 6.69 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |