C34H30FNO6 — CID 501367
1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-fluoroindole-2,3-dione (PubChem CID 501367) has the molecular formula C34H30FNO6 and a molecular weight of 567.61 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-fluoroindole-2,3-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 501367 |
| Molecular Formula | C34H30FNO6 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-5-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c2ccc(F)cc21 |
| InChI | InChI=1S/C34H30FNO6/c35-26-16-17-28-27(18-26)30(37)33(38)36(28)34-32(41-21-25-14-8-3-9-15-25)31(40-20-24-12-6-2-7-13-24)29(42-34)22-39-19-23-10-4-1-5-11-23/h1-18,29,31-32,34H,19-22H2/t29-,31-,32-,34-/m1/s1 |
| InChIKey | YSGZYXILDNENGQ-UVBUXLLRSA-N |
| XLogP | 5.47 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|