C43H40FNO6 — CID 87748609
5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole-3-carbaldehyde (PubChem CID 87748609) has the molecular formula C43H40FNO6 and a molecular weight of 685.79 g/mol. Its IUPAC name is 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole-3-carbaldehyde.
| Compound Name | 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 87748609 |
| Molecular Formula | C43H40FNO6 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.28 |
| IUPAC Name | 5-fluoro-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole-3-carbaldehyde |
| SMILES | O=Cc1cn([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c2ccc(F)cc12 |
| InChI | InChI=1S/C43H40FNO6/c44-36-21-22-38-37(23-36)35(25-46)24-45(38)43-42(50-29-34-19-11-4-12-20-34)41(49-28-33-17-9-3-10-18-33)40(48-27-32-15-7-2-8-16-32)39(51-43)30-47-26-31-13-5-1-6-14-31/h1-25,39-43H,26-30H2/t39-,40-,41+,42-,43-/m1/s1 |
| InChIKey | YKMCWPMVUYTTIX-BQLIBBPVSA-N |
| XLogP | 8.46 |
| TPSA | 68.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|