C41H46N2O6 — CID 10439370
N,N-diethyl-2-[1-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-3-yl]acetamide (PubChem CID 10439370) has the molecular formula C41H46N2O6 and a molecular weight of 662.83 g/mol. Its IUPAC name is N,N-diethyl-2-[1-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-3-yl]acetamide.
| Compound Name | N,N-diethyl-2-[1-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 10439370 |
| Molecular Formula | C41H46N2O6 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | N,N-diethyl-2-[1-[(2R,3R,4R,5R,6R)-3-hydroxy-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-3-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cc1cn([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C41H46N2O6/c1-3-42(4-2)37(44)24-33-25-43(35-23-15-14-22-34(33)35)41-38(45)40(48-28-32-20-12-7-13-21-32)39(47-27-31-18-10-6-11-19-31)36(49-41)29-46-26-30-16-8-5-9-17-30/h5-23,25,36,38-41,45H,3-4,24,26-29H2,1-2H3/t36-,38-,39-,40-,41-/m1/s1 |
| InChIKey | LAUKJLJDDZOZPO-WSIPKPPJSA-N |
| XLogP | 6.70 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |