C45H47NO4 — CID 58242640
3-[(4-ethylphenyl)methyl]-1-[(3R,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole (PubChem CID 58242640) has the molecular formula C45H47NO4 and a molecular weight of 665.87 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)methyl]-1-[(3R,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole.
| Compound Name | 3-[(4-ethylphenyl)methyl]-1-[(3R,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole |
|---|---|
| PubChem CID | 58242640 |
| Molecular Formula | C45H47NO4 |
| Molecular Weight | 665.87 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | 3-[(4-ethylphenyl)methyl]-1-[(3R,4S,5R,6R)-6-ethyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]indole |
| SMILES | CCc1ccc(Cc2cn(C3O[C@H](CC)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C45H47NO4/c1-3-33-24-26-34(27-25-33)28-38-29-46(40-23-15-14-22-39(38)40)45-44(49-32-37-20-12-7-13-21-37)43(48-31-36-18-10-6-11-19-36)42(41(4-2)50-45)47-30-35-16-8-5-9-17-35/h5-27,29,41-45H,3-4,28,30-32H2,1-2H3/t41-,42-,43+,44-,45?/m1/s1 |
| InChIKey | OUKCBQAJCCXMTK-GPJAIITESA-N |
| XLogP | 9.86 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.87 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |