C44H44FNO5 — CID 69245115
1-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-6-methylindole (PubChem CID 69245115) has the molecular formula C44H44FNO5 and a molecular weight of 685.84 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-6-methylindole.
| Compound Name | 1-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-6-methylindole |
|---|---|
| PubChem CID | 69245115 |
| Molecular Formula | C44H44FNO5 |
| Molecular Weight | 685.84 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6S)-6-(fluoromethyl)-3,4,5-tris(phenylmethoxy)oxan-2-yl]-3-[(4-methoxyphenyl)methyl]-6-methylindole |
| SMILES | COc1ccc(Cc2cn([C@@H]3O[C@H](CF)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c3cc(C)ccc23)cc1 |
| InChI | InChI=1S/C44H44FNO5/c1-31-18-23-38-36(25-32-19-21-37(47-2)22-20-32)27-46(39(38)24-31)44-43(50-30-35-16-10-5-11-17-35)42(49-29-34-14-8-4-9-15-34)41(40(26-45)51-44)48-28-33-12-6-3-7-13-33/h3-24,27,40-44H,25-26,28-30H2,1-2H3/t40-,41-,42+,43-,44-/m1/s1 |
| InChIKey | WPYPSGAJJZWZEY-LUKFIAJXSA-N |
| XLogP | 9.17 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.84 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |