C34H35FO5 — CID 134423333
(3S,6R)-2-(fluoromethyl)-6-(4-methylphenoxy)-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 134423333) has the molecular formula C34H35FO5 and a molecular weight of 542.65 g/mol. Its IUPAC name is (3S,6R)-2-(fluoromethyl)-6-(4-methylphenoxy)-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (3S,6R)-2-(fluoromethyl)-6-(4-methylphenoxy)-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 134423333 |
| Molecular Formula | C34H35FO5 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (3S,6R)-2-(fluoromethyl)-6-(4-methylphenoxy)-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | Cc1ccc(O[C@H]2OC(CF)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H35FO5/c1-25-17-19-29(20-18-25)39-34-33(38-24-28-15-9-4-10-16-28)32(37-23-27-13-7-3-8-14-27)31(30(21-35)40-34)36-22-26-11-5-2-6-12-26/h2-20,30-34H,21-24H2,1H3/t30?,31-,32?,33?,34+/m1/s1 |
| InChIKey | GWZHKOBOEJXQPL-QQZOYXNKSA-N |
| XLogP | 6.82 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |