C35H36FNO5 — CID 90441592
3-[4-[(2R,3S,4S,5S,6S)-6-(fluoromethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxyphenyl]-N-methylbenzamide (PubChem CID 90441592) has the molecular formula C35H36FNO5 and a molecular weight of 569.67 g/mol. Its IUPAC name is 3-[4-[(2R,3S,4S,5S,6S)-6-(fluoromethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxyphenyl]-N-methylbenzamide.
| Compound Name | 3-[4-[(2R,3S,4S,5S,6S)-6-(fluoromethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxyphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 90441592 |
| Molecular Formula | C35H36FNO5 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | 3-[4-[(2R,3S,4S,5S,6S)-6-(fluoromethyl)-5-methyl-3,4-bis(phenylmethoxy)oxan-2-yl]oxyphenyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](CF)[C@@H](C)[C@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C35H36FNO5/c1-24-31(21-36)42-35(41-30-18-16-27(17-19-30)28-14-9-15-29(20-28)34(38)37-2)33(40-23-26-12-7-4-8-13-26)32(24)39-22-25-10-5-3-6-11-25/h3-20,24,31-33,35H,21-23H2,1-2H3,(H,37,38)/t24-,31-,32+,33+,35+/m1/s1 |
| InChIKey | IUMQCELSFGELEI-YZOHKOTNSA-N |
| XLogP | 6.59 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |