C48H38O12 — CID 46837524
methyl 3-[4-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]benzoate (PubChem CID 46837524) has the molecular formula C48H38O12 and a molecular weight of 806.82 g/mol. Its IUPAC name is methyl 3-[4-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 3-[4-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 46837524 |
| Molecular Formula | C48H38O12 |
| Molecular Weight | 806.82 g/mol |
| Exact Mass | 806.24 |
| IUPAC Name | methyl 3-[4-[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-(benzoyloxymethyl)oxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](COC(=O)c4ccccc4)[C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@H]3OC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C48H38O12/c1-54-43(49)37-24-14-23-36(29-37)31-25-27-38(28-26-31)56-48-42(60-47(53)35-21-12-5-13-22-35)41(59-46(52)34-19-10-4-11-20-34)40(58-45(51)33-17-8-3-9-18-33)39(57-48)30-55-44(50)32-15-6-2-7-16-32/h2-29,39-42,48H,30H2,1H3/t39-,40-,41+,42-,48+/m1/s1 |
| InChIKey | AMKGYSNKMPMRIN-IVFLOHHBSA-N |
| XLogP | 7.78 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.82 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|