C31H25NO8 — CID 70171015
[(2R,3R,4R)-3,4-dibenzoyloxy-5-pyridin-3-yloxyoxolan-2-yl]methyl benzoate (PubChem CID 70171015) has the molecular formula C31H25NO8 and a molecular weight of 539.54 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-5-pyridin-3-yloxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-pyridin-3-yloxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 70171015 |
| Molecular Formula | C31H25NO8 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5-pyridin-3-yloxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(Oc2cccnc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H25NO8/c33-28(21-11-4-1-5-12-21)36-20-25-26(39-29(34)22-13-6-2-7-14-22)27(40-30(35)23-15-8-3-9-16-23)31(38-25)37-24-17-10-18-32-19-24/h1-19,25-27,31H,20H2/t25-,26-,27-,31?/m1/s1 |
| InChIKey | GEZTWXRJGOCJSR-ABUXTVLRSA-N |
| XLogP | 4.49 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|