C28H30O12 — CID 67111323
methyl 3-[4-[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]benzoate (PubChem CID 67111323) has the molecular formula C28H30O12 and a molecular weight of 558.54 g/mol. Its IUPAC name is methyl 3-[4-[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]benzoate.
| Compound Name | methyl 3-[4-[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 67111323 |
| Molecular Formula | C28H30O12 |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | methyl 3-[4-[(2R,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyphenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C28H30O12/c1-15(29)35-14-23-24(36-16(2)30)25(37-17(3)31)26(38-18(4)32)28(40-23)39-22-11-9-19(10-12-22)20-7-6-8-21(13-20)27(33)34-5/h6-13,23-26,28H,14H2,1-5H3/t23-,24-,25-,26-,28+/m1/s1 |
| InChIKey | QCWCGGMLXGDUNF-UMGWPWBVSA-N |
| XLogP | 2.60 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|