C48H46O7 — CID 70137852
1-[2-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(4-phenylphenyl)methoxymethyl]oxan-2-yl]oxyphenyl]ethanone (PubChem CID 70137852) has the molecular formula C48H46O7 and a molecular weight of 734.89 g/mol. Its IUPAC name is 1-[2-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(4-phenylphenyl)methoxymethyl]oxan-2-yl]oxyphenyl]ethanone.
| Compound Name | 1-[2-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(4-phenylphenyl)methoxymethyl]oxan-2-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 70137852 |
| Molecular Formula | C48H46O7 |
| Molecular Weight | 734.89 g/mol |
| Exact Mass | 734.32 |
| IUPAC Name | 1-[2-[(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-[(4-phenylphenyl)methoxymethyl]oxan-2-yl]oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccccc1OC1O[C@H](COCc2ccc(-c3ccccc3)cc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H46O7/c1-35(49)42-24-14-15-25-43(42)54-48-47(53-33-38-20-10-4-11-21-38)46(52-32-37-18-8-3-9-19-37)45(51-31-36-16-6-2-7-17-36)44(55-48)34-50-30-39-26-28-41(29-27-39)40-22-12-5-13-23-40/h2-29,44-48H,30-34H2,1H3/t44-,45-,46+,47-,48?/m1/s1 |
| InChIKey | JFQHZLZQLFYMBU-KPCABPGFSA-N |
| XLogP | 9.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.89 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |