C43H44O6 — CID 102451516
(2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-prop-2-enylphenoxy)oxane (PubChem CID 102451516) has the molecular formula C43H44O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-prop-2-enylphenoxy)oxane.
| Compound Name | (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-prop-2-enylphenoxy)oxane |
|---|---|
| PubChem CID | 102451516 |
| Molecular Formula | C43H44O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-(2-prop-2-enylphenoxy)oxane |
| SMILES | C=CCc1ccccc1O[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H44O6/c1-2-17-37-26-15-16-27-38(37)48-43-42(47-31-36-24-13-6-14-25-36)41(46-30-35-22-11-5-12-23-35)40(45-29-34-20-9-4-10-21-34)39(49-43)32-44-28-33-18-7-3-8-19-33/h2-16,18-27,39-43H,1,17,28-32H2/t39-,40-,41+,42+,43+/m1/s1 |
| InChIKey | ZCGAQOTVPCYFBJ-FYYRRIAOSA-N |
| XLogP | 8.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|