C49H52O6 — CID 159854935
(2S,3S,4S,5R,6R)-2-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(2-phenylethyl)-3,4,5-tris(phenylmethoxy)oxane;hydrate (PubChem CID 159854935) has the molecular formula C49H52O6 and a molecular weight of 736.95 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(2-phenylethyl)-3,4,5-tris(phenylmethoxy)oxane;hydrate.
| Compound Name | (2S,3S,4S,5R,6R)-2-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(2-phenylethyl)-3,4,5-tris(phenylmethoxy)oxane;hydrate |
|---|---|
| PubChem CID | 159854935 |
| Molecular Formula | C49H52O6 |
| Molecular Weight | 736.95 g/mol |
| Exact Mass | 736.38 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[3-[(4-methoxyphenyl)methyl]-4-methylphenyl]-6-(2-phenylethyl)-3,4,5-tris(phenylmethoxy)oxane;hydrate |
| SMILES | COc1ccc(Cc2cc([C@@H]3O[C@H](CCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2C)cc1.O |
| InChI | InChI=1S/C49H50O5.H2O/c1-36-23-27-42(32-43(36)31-38-24-28-44(50-2)29-25-38)46-48(52-34-40-19-11-5-12-20-40)49(53-35-41-21-13-6-14-22-41)47(51-33-39-17-9-4-10-18-39)45(54-46)30-26-37-15-7-3-8-16-37;/h3-25,27-29,32,45-49H,26,30-31,33-35H2,1-2H3;1H2/t45-,46+,47-,48?,49+;/m1./s1 |
| InChIKey | PQZJRDHKTOFLHE-YAUXQSFBSA-N |
| XLogP | 9.60 |
| TPSA | 77.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.95 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |