C48H52O7 — CID 155754179
(2R,3R,4R,5S,6S)-6-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxane-2-carboxylic acid (PubChem CID 155754179) has the molecular formula C48H52O7 and a molecular weight of 740.94 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-6-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5S,6S)-6-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 155754179 |
| Molecular Formula | C48H52O7 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.37 |
| IUPAC Name | (2R,3R,4R,5S,6S)-6-[4-methyl-3-[[4-(4-prop-2-enoxybutyl)phenyl]methyl]phenyl]-3,4,5-tris(phenylmethoxy)oxane-2-carboxylic acid |
| SMILES | C=CCOCCCCc1ccc(Cc2cc([C@@H]3O[C@@H](C(=O)O)[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)ccc2C)cc1 |
| InChI | InChI=1S/C48H52O7/c1-3-28-51-29-14-13-15-36-23-25-37(26-24-36)30-42-31-41(27-22-35(42)2)43-44(52-32-38-16-7-4-8-17-38)45(53-33-39-18-9-5-10-19-39)46(47(55-43)48(49)50)54-34-40-20-11-6-12-21-40/h3-12,16-27,31,43-47H,1,13-15,28-30,32-34H2,2H3,(H,49,50)/t43-,44?,45+,46+,47+/m0/s1 |
| InChIKey | RCZHYGPLWWOANQ-LNQMHJQASA-N |
| XLogP | 9.39 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|