C52H54O7 — CID 89453284
(2S,3S,4R,5R,6R)-2-[5-[(4-methoxyphenyl)methyl]-2-(prop-2-enoxymethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 89453284) has the molecular formula C52H54O7 and a molecular weight of 791.00 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[5-[(4-methoxyphenyl)methyl]-2-(prop-2-enoxymethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2S,3S,4R,5R,6R)-2-[5-[(4-methoxyphenyl)methyl]-2-(prop-2-enoxymethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 89453284 |
| Molecular Formula | C52H54O7 |
| Molecular Weight | 791.00 g/mol |
| Exact Mass | 790.39 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[5-[(4-methoxyphenyl)methyl]-2-(prop-2-enoxymethyl)phenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=CCOCc1ccc(Cc2ccc(OC)cc2)cc1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C52H54O7/c1-3-30-54-37-45-27-24-44(31-39-25-28-46(53-2)29-26-39)32-47(45)49-51(57-35-42-20-12-6-13-21-42)52(58-36-43-22-14-7-15-23-43)50(56-34-41-18-10-5-11-19-41)48(59-49)38-55-33-40-16-8-4-9-17-40/h3-29,32,48-52H,1,30-31,33-38H2,2H3/t48-,49+,50-,51?,52+/m1/s1 |
| InChIKey | NFVQBHSGOOUZMZ-QISSHCBFSA-N |
| XLogP | 10.40 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.00 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|