C37H41NO6 — CID 100969791
(2R,3R,4R,5S,6R)-5-[(4-methoxyphenyl)methoxy]-N-phenyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-amine (PubChem CID 100969791) has the molecular formula C37H41NO6 and a molecular weight of 595.74 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-5-[(4-methoxyphenyl)methoxy]-N-phenyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-amine.
| Compound Name | (2R,3R,4R,5S,6R)-5-[(4-methoxyphenyl)methoxy]-N-phenyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-amine |
|---|---|
| PubChem CID | 100969791 |
| Molecular Formula | C37H41NO6 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | (2R,3R,4R,5S,6R)-5-[(4-methoxyphenyl)methoxy]-N-phenyl-4-phenylmethoxy-6-(phenylmethoxymethyl)-2-prop-2-enoxyoxan-3-amine |
| SMILES | C=CCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccc(OC)cc2)[C@H](OCc2ccccc2)[C@H]1Nc1ccccc1 |
| InChI | InChI=1S/C37H41NO6/c1-3-23-41-37-34(38-31-17-11-6-12-18-31)36(43-25-29-15-9-5-10-16-29)35(42-26-30-19-21-32(39-2)22-20-30)33(44-37)27-40-24-28-13-7-4-8-14-28/h3-22,33-38H,1,23-27H2,2H3/t33-,34-,35-,36-,37-/m1/s1 |
| InChIKey | CIKYOWZVZFGYDW-LQHPVFTQSA-N |
| XLogP | 6.79 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|