C50H48BrNO5 — CID 69244545
3-[(4-bromophenyl)methyl]-4-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole (PubChem CID 69244545) has the molecular formula C50H48BrNO5 and a molecular weight of 822.84 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-4-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole.
| Compound Name | 3-[(4-bromophenyl)methyl]-4-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
|---|---|
| PubChem CID | 69244545 |
| Molecular Formula | C50H48BrNO5 |
| Molecular Weight | 822.84 g/mol |
| Exact Mass | 821.27 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-4-methyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indole |
| SMILES | Cc1cccc2c1c(Cc1ccc(Br)cc1)cn2[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C50H48BrNO5/c1-36-15-14-24-44-46(36)42(29-37-25-27-43(51)28-26-37)30-52(44)50-49(56-34-41-22-12-5-13-23-41)48(55-33-40-20-10-4-11-21-40)47(54-32-39-18-8-3-9-19-39)45(57-50)35-53-31-38-16-6-2-7-17-38/h2-28,30,45,47-50H,29,31-35H2,1H3/t45-,47-,48+,49-,50-/m1/s1 |
| InChIKey | LPJCJKUODKAYLS-FBEPPCAFSA-N |
| XLogP | 11.17 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.84 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |