C57H65NO5Si — CID 68633242
tert-butyl-[3-[(4-ethylphenyl)methyl]-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-1-yl]-dimethylsilane (PubChem CID 68633242) has the molecular formula C57H65NO5Si and a molecular weight of 872.24 g/mol. Its IUPAC name is tert-butyl-[3-[(4-ethylphenyl)methyl]-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-1-yl]-dimethylsilane.
| Compound Name | tert-butyl-[3-[(4-ethylphenyl)methyl]-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 68633242 |
| Molecular Formula | C57H65NO5Si |
| Molecular Weight | 872.24 g/mol |
| Exact Mass | 871.46 |
| IUPAC Name | tert-butyl-[3-[(4-ethylphenyl)methyl]-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]indol-1-yl]-dimethylsilane |
| SMILES | CCc1ccc(Cc2cn([Si](C)(C)C(C)(C)C)c3ccc([C@@H]4O[C@H](COCc5ccccc5)[C@@H](OCc5ccccc5)[C@H](OCc5ccccc5)[C@H]4OCc4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C57H65NO5Si/c1-7-42-28-30-43(31-29-42)34-49-36-58(64(5,6)57(2,3)4)51-33-32-48(35-50(49)51)53-55(61-39-46-24-16-10-17-25-46)56(62-40-47-26-18-11-19-27-47)54(60-38-45-22-14-9-15-23-45)52(63-53)41-59-37-44-20-12-8-13-21-44/h8-33,35-36,52-56H,7,34,37-41H2,1-6H3/t52-,53+,54-,55+,56+/m1/s1 |
| InChIKey | XXKMGZBRNZVUGK-UQPIPOSESA-N |
| XLogP | 13.06 |
| TPSA | 51.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.24 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|