C49H48O6 — CID 134498396
2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol (PubChem CID 134498396) has the molecular formula C49H48O6 and a molecular weight of 732.92 g/mol. Its IUPAC name is 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol.
| Compound Name | 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol |
|---|---|
| PubChem CID | 134498396 |
| Molecular Formula | C49H48O6 |
| Molecular Weight | 732.92 g/mol |
| Exact Mass | 732.35 |
| IUPAC Name | 2-(3-bicyclo[4.2.0]octa-1(6),2,4-trienylmethyl)-4-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenol |
| SMILES | Oc1ccc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)cc1Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C49H48O6/c50-44-26-25-42(29-43(44)28-39-21-22-40-23-24-41(40)27-39)46-48(53-32-37-17-9-3-10-18-37)49(54-33-38-19-11-4-12-20-38)47(52-31-36-15-7-2-8-16-36)45(55-46)34-51-30-35-13-5-1-6-14-35/h1-22,25-27,29,45-50H,23-24,28,30-34H2/t45-,46+,47-,48+,49+/m1/s1 |
| InChIKey | VSSTZMPFYZPDHK-WXOBWUEKSA-N |
| XLogP | 9.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.92 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |