C43H45Cl2NO6 — CID 67995269
1-amino-3-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]propan-2-one;hydrochloride (PubChem CID 67995269) has the molecular formula C43H45Cl2NO6 and a molecular weight of 742.74 g/mol. Its IUPAC name is 1-amino-3-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]propan-2-one;hydrochloride.
| Compound Name | 1-amino-3-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]propan-2-one;hydrochloride |
|---|---|
| PubChem CID | 67995269 |
| Molecular Formula | C43H45Cl2NO6 |
| Molecular Weight | 742.74 g/mol |
| Exact Mass | 741.26 |
| IUPAC Name | 1-amino-3-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]propan-2-one;hydrochloride |
| SMILES | Cl.NCC(=O)Cc1cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C43H44ClNO6.ClH/c44-38-22-21-35(23-36(38)24-37(46)25-45)40-42(49-28-33-17-9-3-10-18-33)43(50-29-34-19-11-4-12-20-34)41(48-27-32-15-7-2-8-16-32)39(51-40)30-47-26-31-13-5-1-6-14-31;/h1-23,39-43H,24-30,45H2;1H/t39-,40+,41-,42?,43+;/m1./s1 |
| InChIKey | MGINZBJHZPEDJH-ITXMEZHQSA-N |
| XLogP | 8.24 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.74 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |