C45H46ClNO8 — CID 67288462
methyl 2-[[2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]acetyl]amino]acetate (PubChem CID 67288462) has the molecular formula C45H46ClNO8 and a molecular weight of 764.32 g/mol. Its IUPAC name is methyl 2-[[2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 67288462 |
| Molecular Formula | C45H46ClNO8 |
| Molecular Weight | 764.32 g/mol |
| Exact Mass | 763.29 |
| IUPAC Name | methyl 2-[[2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1cc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C45H46ClNO8/c1-50-41(49)26-47-40(48)25-37-24-36(22-23-38(37)46)42-44(53-29-34-18-10-4-11-19-34)45(54-30-35-20-12-5-13-21-35)43(52-28-33-16-8-3-9-17-33)39(55-42)31-51-27-32-14-6-2-7-15-32/h2-24,39,42-45H,25-31H2,1H3,(H,47,48)/t39-,42+,43-,44?,45+/m1/s1 |
| InChIKey | NHVBANVONMEGRF-SOZLBATNSA-N |
| XLogP | 7.58 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.32 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |