C30H51ClN2O6 — CID 67471448
2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]acetohydrazide (PubChem CID 67471448) has the molecular formula C30H51ClN2O6 and a molecular weight of 571.20 g/mol. Its IUPAC name is 2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]acetohydrazide.
| Compound Name | 2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 67471448 |
| Molecular Formula | C30H51ClN2O6 |
| Molecular Weight | 571.20 g/mol |
| Exact Mass | 570.34 |
| IUPAC Name | 2-[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]acetohydrazide |
| SMILES | CCCCOC[C@H]1O[C@@H](c2ccc(Cl)c(CC(=O)NN)c2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C30H51ClN2O6/c1-5-9-15-35-21-25-28(36-16-10-6-2)30(38-18-12-8-4)29(37-17-11-7-3)27(39-25)22-13-14-24(31)23(19-22)20-26(34)33-32/h13-14,19,25,27-30H,5-12,15-18,20-21,32H2,1-4H3,(H,33,34)/t25-,27+,28-,29?,30+/m1/s1 |
| InChIKey | XHPQHTZEHICIPG-QMMFXCGOSA-N |
| XLogP | 5.68 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.20 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|