C29H48BrClO5 — CID 70650758
(3S,4R,5R,6R)-2-[3-(bromomethyl)-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane (PubChem CID 70650758) has the molecular formula C29H48BrClO5 and a molecular weight of 592.06 g/mol. Its IUPAC name is (3S,4R,5R,6R)-2-[3-(bromomethyl)-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane.
| Compound Name | (3S,4R,5R,6R)-2-[3-(bromomethyl)-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
|---|---|
| PubChem CID | 70650758 |
| Molecular Formula | C29H48BrClO5 |
| Molecular Weight | 592.06 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | (3S,4R,5R,6R)-2-[3-(bromomethyl)-4-chlorophenyl]-3,4,5-tributoxy-6-(butoxymethyl)oxane |
| SMILES | CCCCOC[C@H]1OC(c2ccc(Cl)c(CBr)c2)C(OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C29H48BrClO5/c1-5-9-15-32-21-25-27(33-16-10-6-2)29(35-18-12-8-4)28(34-17-11-7-3)26(36-25)22-13-14-24(31)23(19-22)20-30/h13-14,19,25-29H,5-12,15-18,20-21H2,1-4H3/t25-,26?,27-,28?,29+/m1/s1 |
| InChIKey | UUMZLBWEDSKKBN-SGHKMDKVSA-N |
| XLogP | 8.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.06 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|