C36H30N2O6 — CID 23240504
[(2R,4R,5R,6S)-11-methyl-10-oxo-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] benzoate (PubChem CID 23240504) has the molecular formula C36H30N2O6 and a molecular weight of 586.64 g/mol. Its IUPAC name is [(2R,4R,5R,6S)-11-methyl-10-oxo-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] benzoate.
| Compound Name | [(2R,4R,5R,6S)-11-methyl-10-oxo-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] benzoate |
|---|---|
| PubChem CID | 23240504 |
| Molecular Formula | C36H30N2O6 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(2R,4R,5R,6S)-11-methyl-10-oxo-4-(trityloxymethyl)-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-5-yl] benzoate |
| SMILES | Cc1cn2c(nc1=O)O[C@H]1[C@H](OC(=O)c3ccccc3)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C36H30N2O6/c1-24-22-38-33-31(44-35(38)37-32(24)39)30(43-34(40)25-14-6-2-7-15-25)29(42-33)23-41-36(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-22,29-31,33H,23H2,1H3/t29-,30-,31+,33-/m1/s1 |
| InChIKey | YJMPJIZYEYLUJH-RASQHNTCSA-N |
| XLogP | 5.44 |
| TPSA | 88.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|