C51H46N2O9 — CID 10010701
(2R,4R,5R,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one (PubChem CID 10010701) has the molecular formula C51H46N2O9 and a molecular weight of 830.93 g/mol. Its IUPAC name is (2R,4R,5R,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one.
| Compound Name | (2R,4R,5R,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
|---|---|
| PubChem CID | 10010701 |
| Molecular Formula | C51H46N2O9 |
| Molecular Weight | 830.93 g/mol |
| Exact Mass | 830.32 |
| IUPAC Name | (2R,4R,5R,6S)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,7-dioxa-1,9-diazatricyclo[6.4.0.02,6]dodeca-8,11-dien-10-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H]3[C@@H](Oc4nc(=O)ccn43)[C@@H]2OC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C51H46N2O9/c1-55-40-23-15-36(16-24-40)50(34-11-7-5-8-12-34,37-17-25-41(56-2)26-18-37)59-33-44-46(47-48(60-44)53-32-31-45(54)52-49(53)61-47)62-51(35-13-9-6-10-14-35,38-19-27-42(57-3)28-20-38)39-21-29-43(58-4)30-22-39/h5-32,44,46-48H,33H2,1-4H3/t44-,46-,47+,48-/m1/s1 |
| InChIKey | DNAXMPHYKYLOFJ-NMUBUHBBSA-N |
| XLogP | 8.32 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.93 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|