C48H41FN2O5 — CID 14608005
1-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one (PubChem CID 14608005) has the molecular formula C48H41FN2O5 and a molecular weight of 744.86 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one |
|---|---|
| PubChem CID | 14608005 |
| Molecular Formula | C48H41FN2O5 |
| Molecular Weight | 744.86 g/mol |
| Exact Mass | 744.30 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-fluoro-4-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-4-methoxypyrimidin-2-one |
| SMILES | COc1ccn([C@@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](OC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@H]2F)c(=O)n1 |
| InChI | InChI=1S/C48H41FN2O5/c1-53-42-32-33-51(46(52)50-42)45-43(49)44(56-48(38-26-14-5-15-27-38,39-28-16-6-17-29-39)40-30-18-7-19-31-40)41(55-45)34-54-47(35-20-8-2-9-21-35,36-22-10-3-11-23-36)37-24-12-4-13-25-37/h2-33,41,43-45H,34H2,1H3/t41-,43-,44-,45-/m1/s1 |
| InChIKey | BSLDDENCCALQKR-LKZJOZGTSA-N |
| XLogP | 8.87 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.86 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|