C30H33N4O8P — CID 56637004
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxyphosphonamidous acid (PubChem CID 56637004) has the molecular formula C30H33N4O8P and a molecular weight of 608.59 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxyphosphonamidous acid.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxyphosphonamidous acid |
|---|---|
| PubChem CID | 56637004 |
| Molecular Formula | C30H33N4O8P |
| Molecular Weight | 608.59 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-3-yl]oxyphosphonamidous acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@H](O)[C@@H]2OP(N)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H33N4O8P/c1-38-22-12-8-20(9-13-22)30(19-6-4-3-5-7-19,21-10-14-23(39-2)15-11-21)40-18-24-27(42-43(32)37)26(35)28(41-24)34-17-16-25(31)33-29(34)36/h3-17,24,26-28,35,37H,18,32H2,1-2H3,(H2,31,33,36)/t24-,26-,27-,28-,43?/m1/s1 |
| InChIKey | ZZRNYOPMYIHYNO-PDKKKNOISA-N |
| XLogP | 2.67 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|