C32H33N3O8 — CID 66991095
4-amino-1-[(2R,3S,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxopropyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 66991095) has the molecular formula C32H33N3O8 and a molecular weight of 587.63 g/mol. Its IUPAC name is 4-amino-1-[(2R,3S,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxopropyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3S,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxopropyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 66991095 |
| Molecular Formula | C32H33N3O8 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 4-amino-1-[(2R,3S,4S,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxopropyl]-3,4-dihydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1ccc(C(OC(C(C)=O)[C@H]2O[C@@H](n3ccc(N)nc3=O)[C@@H](O)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O8/c1-19(36)28(29-26(37)27(38)30(42-29)35-18-17-25(33)34-31(35)39)43-32(20-7-5-4-6-8-20,21-9-13-23(40-2)14-10-21)22-11-15-24(41-3)16-12-22/h4-18,26-30,37-38H,1-3H3,(H2,33,34,39)/t26-,27-,28?,29-,30+/m0/s1 |
| InChIKey | GBDDYRVZSALNGA-HDTUDNETSA-N |
| XLogP | 2.43 |
| TPSA | 155.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|