C40H41N3O9 — CID 21356198
4-amino-1-[(2R,3R,4R,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxo-2-phenylethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidin-2-one (PubChem CID 21356198) has the molecular formula C40H41N3O9 and a molecular weight of 707.78 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxo-2-phenylethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxo-2-phenylethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 21356198 |
| Molecular Formula | C40H41N3O9 |
| Molecular Weight | 707.78 g/mol |
| Exact Mass | 707.28 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5S)-5-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-2-oxo-2-phenylethyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]pyrimidin-2-one |
| SMILES | COCCO[C@@H]1[C@H](O)[C@@H](C(OC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)C(=O)c2ccccc2)O[C@H]1n1ccc(N)nc1=O |
| InChI | InChI=1S/C40H41N3O9/c1-47-24-25-50-37-34(45)35(51-38(37)43-23-22-32(41)42-39(43)46)36(33(44)26-10-6-4-7-11-26)52-40(27-12-8-5-9-13-27,28-14-18-30(48-2)19-15-28)29-16-20-31(49-3)21-17-29/h4-23,34-38,45H,24-25H2,1-3H3,(H2,41,42,46)/t34-,35+,36?,37-,38-/m1/s1 |
| InChIKey | ANTOXKSKGAOCKN-XRHBTFAVSA-N |
| XLogP | 4.39 |
| TPSA | 153.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|