C38H34FN5O6 — CID 118953083
2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone (PubChem CID 118953083) has the molecular formula C38H34FN5O6 and a molecular weight of 675.72 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone.
| Compound Name | 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone |
|---|---|
| PubChem CID | 118953083 |
| Molecular Formula | C38H34FN5O6 |
| Molecular Weight | 675.72 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | 2-[(2S,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]-2-[bis(4-methoxyphenyl)-phenylmethoxy]-1-phenylethanone |
| SMILES | COc1ccc(C(OC(C(=O)c2ccccc2)[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H34FN5O6/c1-47-27-17-13-25(14-18-27)38(24-11-7-4-8-12-24,26-15-19-28(48-2)20-16-26)50-34(31(45)23-9-5-3-6-10-23)33-32(46)29(39)37(49-33)44-22-43-30-35(40)41-21-42-36(30)44/h3-22,29,32-34,37,46H,1-2H3,(H2,40,41,42)/t29-,32+,33+,34?,37-/m1/s1 |
| InChIKey | NZDZBYGCMDINOX-SPOIHGAOSA-N |
| XLogP | 5.28 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|