C30H29FN6O3 — CID 87662441
(2R,3R,4R,5R)-2-(1-amino-2,2,2-triphenylethyl)-4-fluoro-5-[6-(methoxyamino)purin-9-yl]oxolan-3-ol (PubChem CID 87662441) has the molecular formula C30H29FN6O3 and a molecular weight of 540.60 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(1-amino-2,2,2-triphenylethyl)-4-fluoro-5-[6-(methoxyamino)purin-9-yl]oxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-2-(1-amino-2,2,2-triphenylethyl)-4-fluoro-5-[6-(methoxyamino)purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 87662441 |
| Molecular Formula | C30H29FN6O3 |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | (2R,3R,4R,5R)-2-(1-amino-2,2,2-triphenylethyl)-4-fluoro-5-[6-(methoxyamino)purin-9-yl]oxolan-3-ol |
| SMILES | CONc1ncnc2c1ncn2[C@@H]1O[C@H](C(N)C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C30H29FN6O3/c1-39-36-27-23-28(34-17-33-27)37(18-35-23)29-22(31)24(38)25(40-29)26(32)30(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-18,22,24-26,29,38H,32H2,1H3,(H,33,34,36)/t22-,24+,25+,26?,29-/m1/s1 |
| InChIKey | ZUORRBOBTFXKQZ-RTDDBZOYSA-N |
| XLogP | 3.76 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|