C30H26ClN5O6 — CID 135307416
[(4-chlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)purin-9-yl]oxolan-2-yl]methyl] 4-phenylbenzoate (PubChem CID 135307416) has the molecular formula C30H26ClN5O6 and a molecular weight of 588.02 g/mol. Its IUPAC name is [(4-chlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)purin-9-yl]oxolan-2-yl]methyl] 4-phenylbenzoate.
| Compound Name | [(4-chlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)purin-9-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307416 |
| Molecular Formula | C30H26ClN5O6 |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | [(4-chlorophenyl)-[(2S,3S,4R,5R)-3,4-dihydroxy-5-[6-(methoxyamino)purin-9-yl]oxolan-2-yl]methyl] 4-phenylbenzoate |
| SMILES | CONc1ncnc2c1ncn2[C@@H]1O[C@H](C(OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H26ClN5O6/c1-40-35-27-22-28(33-15-32-27)36(16-34-22)29-24(38)23(37)26(41-29)25(19-11-13-21(31)14-12-19)42-30(39)20-9-7-18(8-10-20)17-5-3-2-4-6-17/h2-16,23-26,29,37-38H,1H3,(H,32,33,35)/t23-,24+,25?,26-,29+/m0/s1 |
| InChIKey | FNYZQOLCZUKFFQ-OTMSEFBESA-N |
| XLogP | 4.34 |
| TPSA | 140.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|