C37H34ClN3O6 — CID 135317413
[[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[4-(3-oxobutyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 135317413) has the molecular formula C37H34ClN3O6 and a molecular weight of 652.15 g/mol. Its IUPAC name is [[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[4-(3-oxobutyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[4-(3-oxobutyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135317413 |
| Molecular Formula | C37H34ClN3O6 |
| Molecular Weight | 652.15 g/mol |
| Exact Mass | 651.21 |
| IUPAC Name | [[(3aR,4R,6R,6aR)-2,2-dimethyl-4-[4-(3-oxobutyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | CC(=O)CCc1ncnc2c1ccn2[C@@H]1O[C@H](C(OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C37H34ClN3O6/c1-22(42)9-18-29-28-19-20-41(34(28)40-21-39-29)35-33-32(46-37(2,3)47-33)31(44-35)30(25-14-16-27(38)17-15-25)45-36(43)26-12-10-24(11-13-26)23-7-5-4-6-8-23/h4-8,10-17,19-21,30-33,35H,9,18H2,1-3H3/t30?,31-,32-,33-,35-/m1/s1 |
| InChIKey | LRZQLBXREHJQTJ-RSQVUMGZSA-N |
| XLogP | 7.29 |
| TPSA | 101.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.15 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |