C37H32ClN3O6 — CID 135316663
[[(3aR,4R,6R,6aR)-4-[4-(3-hydroxybut-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 135316663) has the molecular formula C37H32ClN3O6 and a molecular weight of 650.13 g/mol. Its IUPAC name is [[(3aR,4R,6R,6aR)-4-[4-(3-hydroxybut-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [[(3aR,4R,6R,6aR)-4-[4-(3-hydroxybut-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135316663 |
| Molecular Formula | C37H32ClN3O6 |
| Molecular Weight | 650.13 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | [[(3aR,4R,6R,6aR)-4-[4-(3-hydroxybut-1-ynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | CC(O)C#Cc1ncnc2c1ccn2[C@@H]1O[C@H](C(OC(=O)c2ccc(-c3ccccc3)cc2)c2ccc(Cl)cc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C37H32ClN3O6/c1-22(42)9-18-29-28-19-20-41(34(28)40-21-39-29)35-33-32(46-37(2,3)47-33)31(44-35)30(25-14-16-27(38)17-15-25)45-36(43)26-12-10-24(11-13-26)23-7-5-4-6-8-23/h4-8,10-17,19-22,30-33,35,42H,1-3H3/t22?,30?,31-,32-,33-,35-/m1/s1 |
| InChIKey | PWPMODNTPDKOOM-LAHITQIMSA-N |
| XLogP | 6.50 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.13 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|