C30H22Cl2IN3O5 — CID 135307447
[(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate (PubChem CID 135307447) has the molecular formula C30H22Cl2IN3O5 and a molecular weight of 702.33 g/mol. Its IUPAC name is [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate.
| Compound Name | [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 135307447 |
| Molecular Formula | C30H22Cl2IN3O5 |
| Molecular Weight | 702.33 g/mol |
| Exact Mass | 701.00 |
| IUPAC Name | [(R)-[(2S,3S,4R,5R)-5-(4-chloro-5-iodopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]-(4-chlorophenyl)methyl] 4-phenylbenzoate |
| SMILES | O=C(O[C@H](c1ccc(Cl)cc1)[C@H]1O[C@@H](n2cc(I)c3c(Cl)ncnc32)[C@H](O)[C@@H]1O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22Cl2IN3O5/c31-20-12-10-18(11-13-20)25(41-30(39)19-8-6-17(7-9-19)16-4-2-1-3-5-16)26-23(37)24(38)29(40-26)36-14-21(33)22-27(32)34-15-35-28(22)36/h1-15,23-26,29,37-38H/t23-,24+,25+,26-,29+/m0/s1 |
| InChIKey | HBCOEPUEWIJPJF-MQYJMQNVSA-N |
| XLogP | 6.23 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.33 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|